C21H16Cl2N2O3S — CID 1010318
2,4-dichloro-N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]benzamide (PubChem CID 1010318) has the molecular formula C21H16Cl2N2O3S and a molecular weight of 447.34 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1010318 |
| Molecular Formula | C21H16Cl2N2O3S |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 2,4-dichloro-N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H16Cl2N2O3S/c22-15-5-10-18(19(23)13-15)21(26)24-16-6-8-17(9-7-16)29(27,28)25-12-11-14-3-1-2-4-20(14)25/h1-10,13H,11-12H2,(H,24,26) |
| InChIKey | BLJFYITXVKFKSH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |