C21H16F2N2O3S — CID 4176225
5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(3-fluorophenyl)benzamide (PubChem CID 4176225) has the molecular formula C21H16F2N2O3S and a molecular weight of 414.43 g/mol. Its IUPAC name is 5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(3-fluorophenyl)benzamide.
| Compound Name | 5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(3-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 4176225 |
| Molecular Formula | C21H16F2N2O3S |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(3-fluorophenyl)benzamide |
| SMILES | O=C(Nc1cccc(F)c1)c1cc(S(=O)(=O)N2CCc3ccccc32)ccc1F |
| InChI | InChI=1S/C21H16F2N2O3S/c22-15-5-3-6-16(12-15)24-21(26)18-13-17(8-9-19(18)23)29(27,28)25-11-10-14-4-1-2-7-20(14)25/h1-9,12-13H,10-11H2,(H,24,26) |
| InChIKey | HMNYGAQUKJORDK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |