C21H15BrF2N2O3S — CID 4056630
N-(4-bromo-2-fluorophenyl)-5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluorobenzamide (PubChem CID 4056630) has the molecular formula C21H15BrF2N2O3S and a molecular weight of 493.33 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluorobenzamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 4056630 |
| Molecular Formula | C21H15BrF2N2O3S |
| Molecular Weight | 493.33 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluorobenzamide |
| SMILES | O=C(Nc1ccc(Br)cc1F)c1cc(S(=O)(=O)N2CCc3ccccc32)ccc1F |
| InChI | InChI=1S/C21H15BrF2N2O3S/c22-14-5-8-19(18(24)11-14)25-21(27)16-12-15(6-7-17(16)23)30(28,29)26-10-9-13-3-1-2-4-20(13)26/h1-8,11-12H,9-10H2,(H,25,27) |
| InChIKey | BROUDJSXHWLOQZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |