C22H19ClN2O4S — CID 43036265
2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-(2-hydroxyphenyl)benzamide (PubChem CID 43036265) has the molecular formula C22H19ClN2O4S and a molecular weight of 442.92 g/mol. Its IUPAC name is 2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-(2-hydroxyphenyl)benzamide.
| Compound Name | 2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-(2-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 43036265 |
| Molecular Formula | C22H19ClN2O4S |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N-(2-hydroxyphenyl)benzamide |
| SMILES | O=C(Nc1ccccc1O)c1cc(S(=O)(=O)N2CCCc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C22H19ClN2O4S/c23-18-12-11-16(14-17(18)22(27)24-19-8-2-4-10-21(19)26)30(28,29)25-13-5-7-15-6-1-3-9-20(15)25/h1-4,6,8-12,14,26H,5,7,13H2,(H,24,27) |
| InChIKey | AUFCADHAJZZIMW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|