C23H20ClN3O5S — CID 23120438
N-[2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-3-methyl-2-nitrobenzamide (PubChem CID 23120438) has the molecular formula C23H20ClN3O5S and a molecular weight of 485.95 g/mol. Its IUPAC name is N-[2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-3-methyl-2-nitrobenzamide.
| Compound Name | N-[2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-3-methyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 23120438 |
| Molecular Formula | C23H20ClN3O5S |
| Molecular Weight | 485.95 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | N-[2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-3-methyl-2-nitrobenzamide |
| SMILES | Cc1cccc(C(=O)Nc2cc(S(=O)(=O)N3CCCc4ccccc43)ccc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H20ClN3O5S/c1-15-6-4-9-18(22(15)27(29)30)23(28)25-20-14-17(11-12-19(20)24)33(31,32)26-13-5-8-16-7-2-3-10-21(16)26/h2-4,6-7,9-12,14H,5,8,13H2,1H3,(H,25,28) |
| InChIKey | FDVLHKINFUSYNG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.95 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|