C24H19Cl2N3O7S — CID 2485739
[2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate (PubChem CID 2485739) has the molecular formula C24H19Cl2N3O7S and a molecular weight of 564.40 g/mol. Its IUPAC name is [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate.
| Compound Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2485739 |
| Molecular Formula | C24H19Cl2N3O7S |
| Molecular Weight | 564.40 g/mol |
| Exact Mass | 563.03 |
| IUPAC Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 2-chloro-5-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate |
| SMILES | O=C(COC(=O)c1cc(S(=O)(=O)N2CCCc3ccccc32)ccc1Cl)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C24H19Cl2N3O7S/c25-19-10-8-17(37(34,35)28-11-3-5-15-4-1-2-6-22(15)28)13-18(19)24(31)36-14-23(30)27-21-12-16(29(32)33)7-9-20(21)26/h1-2,4,6-10,12-13H,3,5,11,14H2,(H,27,30) |
| InChIKey | RGCZWDUPMQIUEB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|