C23H20N2O6S — CID 3450676
(3-nitrophenyl)methyl 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate (PubChem CID 3450676) has the molecular formula C23H20N2O6S and a molecular weight of 452.49 g/mol. Its IUPAC name is (3-nitrophenyl)methyl 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate.
| Compound Name | (3-nitrophenyl)methyl 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 3450676 |
| Molecular Formula | C23H20N2O6S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | (3-nitrophenyl)methyl 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate |
| SMILES | O=C(OCc1cccc([N+](=O)[O-])c1)c1ccc(S(=O)(=O)N2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C23H20N2O6S/c26-23(31-16-17-5-3-8-20(15-17)25(27)28)19-10-12-21(13-11-19)32(29,30)24-14-4-7-18-6-1-2-9-22(18)24/h1-3,5-6,8-13,15H,4,7,14,16H2 |
| InChIKey | LZCYMLAVWGAHHY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|