C18H16N2O4S — CID 3487465
cyanomethyl 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate (PubChem CID 3487465) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is cyanomethyl 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate.
| Compound Name | cyanomethyl 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 3487465 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | cyanomethyl 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate |
| SMILES | N#CCOC(=O)c1ccc(S(=O)(=O)N2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H16N2O4S/c19-11-13-24-18(21)15-7-9-16(10-8-15)25(22,23)20-12-3-5-14-4-1-2-6-17(14)20/h1-2,4,6-10H,3,5,12-13H2 |
| InChIKey | CCFVJPRMBSAHMQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |