C23H20BrNO4S — CID 4037193
(4-bromophenyl)methyl 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate (PubChem CID 4037193) has the molecular formula C23H20BrNO4S and a molecular weight of 486.39 g/mol. Its IUPAC name is (4-bromophenyl)methyl 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate.
| Compound Name | (4-bromophenyl)methyl 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 4037193 |
| Molecular Formula | C23H20BrNO4S |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | (4-bromophenyl)methyl 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate |
| SMILES | O=C(OCc1ccc(Br)cc1)c1ccc(S(=O)(=O)N2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C23H20BrNO4S/c24-20-11-7-17(8-12-20)16-29-23(26)19-9-13-21(14-10-19)30(27,28)25-15-3-5-18-4-1-2-6-22(18)25/h1-2,4,6-14H,3,5,15-16H2 |
| InChIKey | UPFGCKYUXWWTGW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |