C23H20ClNO4S — CID 16531667
(3-chlorophenyl)methyl 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate (PubChem CID 16531667) has the molecular formula C23H20ClNO4S and a molecular weight of 441.94 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate.
| Compound Name | (3-chlorophenyl)methyl 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 16531667 |
| Molecular Formula | C23H20ClNO4S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | (3-chlorophenyl)methyl 4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzoate |
| SMILES | O=C(OCc1cccc(Cl)c1)c1ccc(S(=O)(=O)N2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C23H20ClNO4S/c24-20-8-3-5-17(15-20)16-29-23(26)19-10-12-21(13-11-19)30(27,28)25-14-4-7-18-6-1-2-9-22(18)25/h1-3,5-6,8-13,15H,4,7,14,16H2 |
| InChIKey | WPIHMZCOKSKMLP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |