C14H12N2O4S — CID 2952438
1-(3-nitrophenyl)sulfonyl-2,3-dihydroindole (PubChem CID 2952438) has the molecular formula C14H12N2O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is 1-(3-nitrophenyl)sulfonyl-2,3-dihydroindole.
| Compound Name | 1-(3-nitrophenyl)sulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 2952438 |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-(3-nitrophenyl)sulfonyl-2,3-dihydroindole |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C14H12N2O4S/c17-16(18)12-5-3-6-13(10-12)21(19,20)15-9-8-11-4-1-2-7-14(11)15/h1-7,10H,8-9H2 |
| InChIKey | GYIGCFMFXUNFQO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|