C13H11N3O4S — CID 126485505
1-(3-nitrophenyl)sulfonyl-2,3-dihydropyrrolo[2,3-b]pyridine (PubChem CID 126485505) has the molecular formula C13H11N3O4S and a molecular weight of 305.31 g/mol. Its IUPAC name is 1-(3-nitrophenyl)sulfonyl-2,3-dihydropyrrolo[2,3-b]pyridine.
| Compound Name | 1-(3-nitrophenyl)sulfonyl-2,3-dihydropyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 126485505 |
| Molecular Formula | C13H11N3O4S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 1-(3-nitrophenyl)sulfonyl-2,3-dihydropyrrolo[2,3-b]pyridine |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)N2CCc3cccnc32)c1 |
| InChI | InChI=1S/C13H11N3O4S/c17-16(18)11-4-1-5-12(9-11)21(19,20)15-8-6-10-3-2-7-14-13(10)15/h1-5,7,9H,6,8H2 |
| InChIKey | DWMOMCDAPLNPIY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|