C15H14N2O5S — CID 23120118
1-(3-nitrophenyl)sulfonyl-3,5-dihydro-2H-4,1-benzoxazepine (PubChem CID 23120118) has the molecular formula C15H14N2O5S and a molecular weight of 334.35 g/mol. Its IUPAC name is 1-(3-nitrophenyl)sulfonyl-3,5-dihydro-2H-4,1-benzoxazepine.
| Compound Name | 1-(3-nitrophenyl)sulfonyl-3,5-dihydro-2H-4,1-benzoxazepine |
|---|---|
| PubChem CID | 23120118 |
| Molecular Formula | C15H14N2O5S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-(3-nitrophenyl)sulfonyl-3,5-dihydro-2H-4,1-benzoxazepine |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)N2CCOCc3ccccc32)c1 |
| InChI | InChI=1S/C15H14N2O5S/c18-17(19)13-5-3-6-14(10-13)23(20,21)16-8-9-22-11-12-4-1-2-7-15(12)16/h1-7,10H,8-9,11H2 |
| InChIKey | MHCLZWKFPSESGJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|