About silver 3-nitrobenzenesulfonate
silver 3-nitrobenzenesulfonate (PubChem CID 139842266) has the molecular formula C6H4AgNO5S
and a molecular weight of 310.04 g/mol. Its IUPAC name is silver 3-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | silver 3-nitrobenzenesulfonate |
| PubChem CID | 139842266 |
| Molecular Formula | C6H4AgNO5S |
| Molecular Weight | 310.04 g/mol |
| Exact Mass | 308.89 |
| IUPAC Name | silver 3-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)[O-])c1.[Ag+] |
| InChI | InChI=1S/C6H5NO5S.Ag/c8-7(9)5-2-1-3-6(4-5)13(10,11)12;/h1-4H,(H,10,11,12);/q;+1/p-1 |
| InChIKey | GETZNFWUTADNKR-UHFFFAOYSA-M |
| XLogP | 0.50 |
| TPSA | 100.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.04 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze silver 3-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver 3-nitrobenzenesulfonate?
The IUPAC name of silver 3-nitrobenzenesulfonate (CID 139842266) is silver 3-nitrobenzenesulfonate.
What is the SMILES notation for silver 3-nitrobenzenesulfonate?
The canonical SMILES for silver 3-nitrobenzenesulfonate is O=[N+]([O-])c1cccc(S(=O)(=O)[O-])c1.[Ag+].
What is the InChIKey of silver 3-nitrobenzenesulfonate?
The InChIKey is GETZNFWUTADNKR-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5NO5S.Ag/c8-7(9)5-2-1-3-6(4-5)13(10,11)12;/h1-4H,(H,10,11,12);/q;+1/p-1.
What are the key properties of silver 3-nitrobenzenesulfonate?
silver 3-nitrobenzenesulfonate has a molecular weight of 310.04 g/mol, XLogP of 0.50, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for silver 3-nitrobenzenesulfonate is sourced from PubChem (CID 139842266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).