About 3-nitrobenzenesulfonate;(4-propan-2-ylphenyl)iodanium
3-nitrobenzenesulfonate;(4-propan-2-ylphenyl)iodanium (PubChem CID 159399081) has the molecular formula C15H16INO5S
and a molecular weight of 449.27 g/mol. Its IUPAC name is 3-nitrobenzenesulfonate;(4-propan-2-ylphenyl)iodanium.
Molecular Properties
| Compound Name | 3-nitrobenzenesulfonate;(4-propan-2-ylphenyl)iodanium |
| PubChem CID | 159399081 |
| Molecular Formula | C15H16INO5S |
| Molecular Weight | 449.27 g/mol |
| Exact Mass | 448.98 |
| IUPAC Name | 3-nitrobenzenesulfonate;(4-propan-2-ylphenyl)iodanium |
| SMILES | CC(C)c1ccc([IH+])cc1.O=[N+]([O-])c1cccc(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C9H12I.C6H5NO5S/c1-7(2)8-3-5-9(10)6-4-8;8-7(9)5-2-1-3-6(4-5)13(10,11)12/h3-7,10H,1-2H3;1-4H,(H,10,11,12)/q+1;/p-1 |
| InChIKey | LNCMWNYBNFMBMY-UHFFFAOYSA-M |
| XLogP | -0.24 |
| TPSA | 100.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.27 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-nitrobenzenesulfonate;(4-propan-2-ylphenyl)iodanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrobenzenesulfonate;(4-propan-2-ylphenyl)iodanium?
The IUPAC name of 3-nitrobenzenesulfonate;(4-propan-2-ylphenyl)iodanium (CID 159399081) is 3-nitrobenzenesulfonate;(4-propan-2-ylphenyl)iodanium.
What is the SMILES notation for 3-nitrobenzenesulfonate;(4-propan-2-ylphenyl)iodanium?
The canonical SMILES for 3-nitrobenzenesulfonate;(4-propan-2-ylphenyl)iodanium is CC(C)c1ccc([IH+])cc1.O=[N+]([O-])c1cccc(S(=O)(=O)[O-])c1.
What is the InChIKey of 3-nitrobenzenesulfonate;(4-propan-2-ylphenyl)iodanium?
The InChIKey is LNCMWNYBNFMBMY-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H12I.C6H5NO5S/c1-7(2)8-3-5-9(10)6-4-8;8-7(9)5-2-1-3-6(4-5)13(10,11)12/h3-7,10H,1-2H3;1-4H,(H,10,11,12)/q+1;/p-1.
What are the key properties of 3-nitrobenzenesulfonate;(4-propan-2-ylphenyl)iodanium?
3-nitrobenzenesulfonate;(4-propan-2-ylphenyl)iodanium has a molecular weight of 449.27 g/mol, XLogP of -0.24, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrobenzenesulfonate;(4-propan-2-ylphenyl)iodanium is sourced from PubChem (CID 159399081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).