C14H16N2O5S — CID 88506764
benzyl(methyl)azanium;3-nitrobenzenesulfonate (PubChem CID 88506764) has the molecular formula C14H16N2O5S and a molecular weight of 324.36 g/mol. Its IUPAC name is benzyl(methyl)azanium;3-nitrobenzenesulfonate.
| Compound Name | benzyl(methyl)azanium;3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 88506764 |
| Molecular Formula | C14H16N2O5S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | benzyl(methyl)azanium;3-nitrobenzenesulfonate |
| SMILES | C[NH2+]Cc1ccccc1.O=[N+]([O-])c1cccc(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C8H11N.C6H5NO5S/c1-9-7-8-5-3-2-4-6-8;8-7(9)5-2-1-3-6(4-5)13(10,11)12/h2-6,9H,7H2,1H3;1-4H,(H,10,11,12) |
| InChIKey | XEKIRVAKLYMOJU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|