C40H42N4O14S2 — CID 19779034
2-benzoyloxyethyl-[4-[2-benzoyloxyethyl(dimethyl)azaniumyl]phenyl]-dimethylazanium;bis(3-nitrobenzenesulfonate) (PubChem CID 19779034) has the molecular formula C40H42N4O14S2 and a molecular weight of 866.92 g/mol. Its IUPAC name is 2-benzoyloxyethyl-[4-[2-benzoyloxyethyl(dimethyl)azaniumyl]phenyl]-dimethylazanium;bis(3-nitrobenzenesulfonate).
| Compound Name | 2-benzoyloxyethyl-[4-[2-benzoyloxyethyl(dimethyl)azaniumyl]phenyl]-dimethylazanium;bis(3-nitrobenzenesulfonate) |
|---|---|
| PubChem CID | 19779034 |
| Molecular Formula | C40H42N4O14S2 |
| Molecular Weight | 866.92 g/mol |
| Exact Mass | 866.21 |
| IUPAC Name | 2-benzoyloxyethyl-[4-[2-benzoyloxyethyl(dimethyl)azaniumyl]phenyl]-dimethylazanium;bis(3-nitrobenzenesulfonate) |
| SMILES | C[N+](C)(CCOC(=O)c1ccccc1)c1ccc([N+](C)(C)CCOC(=O)c2ccccc2)cc1.O=[N+]([O-])c1cccc(S(=O)(=O)[O-])c1.O=[N+]([O-])c1cccc(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C28H34N2O4.2C6H5NO5S/c1-29(2,19-21-33-27(31)23-11-7-5-8-12-23)25-15-17-26(18-16-25)30(3,4)20-22-34-28(32)24-13-9-6-10-14-24;2*8-7(9)5-2-1-3-6(4-5)13(10,11)12/h5-18H,19-22H2,1-4H3;2*1-4H,(H,10,11,12)/q+2;;/p-2 |
| InChIKey | GPCJCLIFQALADM-UHFFFAOYSA-L |
| XLogP | 5.53 |
| TPSA | 253.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.92 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|