C32H34N2O8S — CID 19774325
2-(4-methoxybenzoyl)oxyethyl-bis[(2-methylphenyl)methyl]azanium;3-nitrobenzenesulfonate (PubChem CID 19774325) has the molecular formula C32H34N2O8S and a molecular weight of 606.70 g/mol. Its IUPAC name is 2-(4-methoxybenzoyl)oxyethyl-bis[(2-methylphenyl)methyl]azanium;3-nitrobenzenesulfonate.
| Compound Name | 2-(4-methoxybenzoyl)oxyethyl-bis[(2-methylphenyl)methyl]azanium;3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 19774325 |
| Molecular Formula | C32H34N2O8S |
| Molecular Weight | 606.70 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | 2-(4-methoxybenzoyl)oxyethyl-bis[(2-methylphenyl)methyl]azanium;3-nitrobenzenesulfonate |
| SMILES | COc1ccc(C(=O)OCC[NH+](Cc2ccccc2C)Cc2ccccc2C)cc1.O=[N+]([O-])c1cccc(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C26H29NO3.C6H5NO5S/c1-20-8-4-6-10-23(20)18-27(19-24-11-7-5-9-21(24)2)16-17-30-26(28)22-12-14-25(29-3)15-13-22;8-7(9)5-2-1-3-6(4-5)13(10,11)12/h4-15H,16-19H2,1-3H3;1-4H,(H,10,11,12) |
| InChIKey | ZJGQUJAFQQIQDQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 140.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.70 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|