C31H31ClN2O7S — CID 19774303
2-(4-chlorobenzoyl)oxyethyl-bis[(2-methylphenyl)methyl]azanium;3-nitrobenzenesulfonate (PubChem CID 19774303) has the molecular formula C31H31ClN2O7S and a molecular weight of 611.12 g/mol. Its IUPAC name is 2-(4-chlorobenzoyl)oxyethyl-bis[(2-methylphenyl)methyl]azanium;3-nitrobenzenesulfonate.
| Compound Name | 2-(4-chlorobenzoyl)oxyethyl-bis[(2-methylphenyl)methyl]azanium;3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 19774303 |
| Molecular Formula | C31H31ClN2O7S |
| Molecular Weight | 611.12 g/mol |
| Exact Mass | 610.15 |
| IUPAC Name | 2-(4-chlorobenzoyl)oxyethyl-bis[(2-methylphenyl)methyl]azanium;3-nitrobenzenesulfonate |
| SMILES | Cc1ccccc1C[NH+](CCOC(=O)c1ccc(Cl)cc1)Cc1ccccc1C.O=[N+]([O-])c1cccc(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C25H26ClNO2.C6H5NO5S/c1-19-7-3-5-9-22(19)17-27(18-23-10-6-4-8-20(23)2)15-16-29-25(28)21-11-13-24(26)14-12-21;8-7(9)5-2-1-3-6(4-5)13(10,11)12/h3-14H,15-18H2,1-2H3;1-4H,(H,10,11,12) |
| InChIKey | UAKXJXGLGNGPTK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.12 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|