C23H20Cl2N2O6S — CID 46371274
ethyl 4-[[(2,6-dichlorophenyl)methyl-(3-nitrophenyl)sulfonylamino]methyl]benzoate (PubChem CID 46371274) has the molecular formula C23H20Cl2N2O6S and a molecular weight of 523.39 g/mol. Its IUPAC name is ethyl 4-[[(2,6-dichlorophenyl)methyl-(3-nitrophenyl)sulfonylamino]methyl]benzoate.
| Compound Name | ethyl 4-[[(2,6-dichlorophenyl)methyl-(3-nitrophenyl)sulfonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 46371274 |
| Molecular Formula | C23H20Cl2N2O6S |
| Molecular Weight | 523.39 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | ethyl 4-[[(2,6-dichlorophenyl)methyl-(3-nitrophenyl)sulfonylamino]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN(Cc2c(Cl)cccc2Cl)S(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H20Cl2N2O6S/c1-2-33-23(28)17-11-9-16(10-12-17)14-26(15-20-21(24)7-4-8-22(20)25)34(31,32)19-6-3-5-18(13-19)27(29)30/h3-13H,2,14-15H2,1H3 |
| InChIKey | TYRCKDWQFXKUBH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|