C25H26FNO4S — CID 4179232
ethyl 4-[[(4-fluoro-3-methylphenyl)sulfonyl-[(4-methylphenyl)methyl]amino]methyl]benzoate (PubChem CID 4179232) has the molecular formula C25H26FNO4S and a molecular weight of 455.55 g/mol. Its IUPAC name is ethyl 4-[[(4-fluoro-3-methylphenyl)sulfonyl-[(4-methylphenyl)methyl]amino]methyl]benzoate.
| Compound Name | ethyl 4-[[(4-fluoro-3-methylphenyl)sulfonyl-[(4-methylphenyl)methyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 4179232 |
| Molecular Formula | C25H26FNO4S |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | ethyl 4-[[(4-fluoro-3-methylphenyl)sulfonyl-[(4-methylphenyl)methyl]amino]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN(Cc2ccc(C)cc2)S(=O)(=O)c2ccc(F)c(C)c2)cc1 |
| InChI | InChI=1S/C25H26FNO4S/c1-4-31-25(28)22-11-9-21(10-12-22)17-27(16-20-7-5-18(2)6-8-20)32(29,30)23-13-14-24(26)19(3)15-23/h5-15H,4,16-17H2,1-3H3 |
| InChIKey | BWUSCBFVKZVIMX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |