C22H27NO4S — CID 15423577
ethyl 4-[[prop-2-enyl-(2,4,6-trimethylphenyl)sulfonylamino]methyl]benzoate (PubChem CID 15423577) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is ethyl 4-[[prop-2-enyl-(2,4,6-trimethylphenyl)sulfonylamino]methyl]benzoate.
| Compound Name | ethyl 4-[[prop-2-enyl-(2,4,6-trimethylphenyl)sulfonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 15423577 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | ethyl 4-[[prop-2-enyl-(2,4,6-trimethylphenyl)sulfonylamino]methyl]benzoate |
| SMILES | C=CCN(Cc1ccc(C(=O)OCC)cc1)S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C22H27NO4S/c1-6-12-23(15-19-8-10-20(11-9-19)22(24)27-7-2)28(25,26)21-17(4)13-16(3)14-18(21)5/h6,8-11,13-14H,1,7,12,15H2,2-5H3 |
| InChIKey | ICLGIQXTUWRKSN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|