C13H16FNO4S — CID 166290411
2-[(2-fluoro-4,6-dimethylphenyl)sulfonyl-prop-2-enylamino]acetic acid (PubChem CID 166290411) has the molecular formula C13H16FNO4S and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[(2-fluoro-4,6-dimethylphenyl)sulfonyl-prop-2-enylamino]acetic acid.
| Compound Name | 2-[(2-fluoro-4,6-dimethylphenyl)sulfonyl-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 166290411 |
| Molecular Formula | C13H16FNO4S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-[(2-fluoro-4,6-dimethylphenyl)sulfonyl-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)S(=O)(=O)c1c(C)cc(C)cc1F |
| InChI | InChI=1S/C13H16FNO4S/c1-4-5-15(8-12(16)17)20(18,19)13-10(3)6-9(2)7-11(13)14/h4,6-7H,1,5,8H2,2-3H3,(H,16,17) |
| InChIKey | NOWOYFAZCHVYSG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|