C11H11ClFNO4S — CID 79264577
2-[(3-chloro-2-fluorophenyl)sulfonyl-prop-2-enylamino]acetic acid (PubChem CID 79264577) has the molecular formula C11H11ClFNO4S and a molecular weight of 307.73 g/mol. Its IUPAC name is 2-[(3-chloro-2-fluorophenyl)sulfonyl-prop-2-enylamino]acetic acid.
| Compound Name | 2-[(3-chloro-2-fluorophenyl)sulfonyl-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 79264577 |
| Molecular Formula | C11H11ClFNO4S |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 2-[(3-chloro-2-fluorophenyl)sulfonyl-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)S(=O)(=O)c1cccc(Cl)c1F |
| InChI | InChI=1S/C11H11ClFNO4S/c1-2-6-14(7-10(15)16)19(17,18)9-5-3-4-8(12)11(9)13/h2-5H,1,6-7H2,(H,15,16) |
| InChIKey | MLKJGDASODUKLO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|