C12H11F3NO4S- — CID 7902269
2-[prop-2-enyl-[2-(trifluoromethyl)phenyl]sulfonylamino]acetate (PubChem CID 7902269) has the molecular formula C12H11F3NO4S- and a molecular weight of 322.28 g/mol. Its IUPAC name is 2-[prop-2-enyl-[2-(trifluoromethyl)phenyl]sulfonylamino]acetate.
| Compound Name | 2-[prop-2-enyl-[2-(trifluoromethyl)phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 7902269 |
| Molecular Formula | C12H11F3NO4S- |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2-[prop-2-enyl-[2-(trifluoromethyl)phenyl]sulfonylamino]acetate |
| SMILES | C=CCN(CC(=O)[O-])S(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO4S/c1-2-7-16(8-11(17)18)21(19,20)10-6-4-3-5-9(10)12(13,14)15/h2-6H,1,7-8H2,(H,17,18)/p-1 |
| InChIKey | HPEIAFFUKVUJOK-UHFFFAOYSA-M |
| XLogP | 0.63 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|