C12H13ClF3NO3S — CID 111117899
4-chloro-N-(2-hydroxyethyl)-N-prop-2-enyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 111117899) has the molecular formula C12H13ClF3NO3S and a molecular weight of 343.75 g/mol. Its IUPAC name is 4-chloro-N-(2-hydroxyethyl)-N-prop-2-enyl-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(2-hydroxyethyl)-N-prop-2-enyl-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 111117899 |
| Molecular Formula | C12H13ClF3NO3S |
| Molecular Weight | 343.75 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 4-chloro-N-(2-hydroxyethyl)-N-prop-2-enyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | C=CCN(CCO)S(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13ClF3NO3S/c1-2-5-17(6-7-18)21(19,20)9-3-4-11(13)10(8-9)12(14,15)16/h2-4,8,18H,1,5-7H2 |
| InChIKey | ZOQQBDRACHRVNU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.75 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|