C21H22ClF3N2O4S — CID 31522157
2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-prop-2-enylamino]-N-[2-(2-methoxyphenyl)ethyl]acetamide (PubChem CID 31522157) has the molecular formula C21H22ClF3N2O4S and a molecular weight of 490.93 g/mol. Its IUPAC name is 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-prop-2-enylamino]-N-[2-(2-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-prop-2-enylamino]-N-[2-(2-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 31522157 |
| Molecular Formula | C21H22ClF3N2O4S |
| Molecular Weight | 490.93 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-prop-2-enylamino]-N-[2-(2-methoxyphenyl)ethyl]acetamide |
| SMILES | C=CCN(CC(=O)NCCc1ccccc1OC)S(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22ClF3N2O4S/c1-3-12-27(14-20(28)26-11-10-15-6-4-5-7-19(15)31-2)32(29,30)16-8-9-18(22)17(13-16)21(23,24)25/h3-9,13H,1,10-12,14H2,2H3,(H,26,28) |
| InChIKey | ZBHUTXDODYJJPK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.93 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|