C17H16ClF3N2O3S2 — CID 30233401
2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-prop-2-enylamino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 30233401) has the molecular formula C17H16ClF3N2O3S2 and a molecular weight of 452.91 g/mol. Its IUPAC name is 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-prop-2-enylamino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-prop-2-enylamino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 30233401 |
| Molecular Formula | C17H16ClF3N2O3S2 |
| Molecular Weight | 452.91 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-prop-2-enylamino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C=CCN(CC(=O)NCc1cccs1)S(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16ClF3N2O3S2/c1-2-7-23(11-16(24)22-10-12-4-3-8-27-12)28(25,26)13-5-6-15(18)14(9-13)17(19,20)21/h2-6,8-9H,1,7,10-11H2,(H,22,24) |
| InChIKey | QMNMFUHHXIGLJO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.91 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|