C22H22N2O4S2 — CID 4787744
2-[(4-acetylphenyl)sulfonyl-benzylamino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 4787744) has the molecular formula C22H22N2O4S2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[(4-acetylphenyl)sulfonyl-benzylamino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(4-acetylphenyl)sulfonyl-benzylamino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4787744 |
| Molecular Formula | C22H22N2O4S2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 2-[(4-acetylphenyl)sulfonyl-benzylamino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N(CC(=O)NCc2cccs2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N2O4S2/c1-17(25)19-9-11-21(12-10-19)30(27,28)24(15-18-6-3-2-4-7-18)16-22(26)23-14-20-8-5-13-29-20/h2-13H,14-16H2,1H3,(H,23,26) |
| InChIKey | DMMURBCMOZHOLB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |