C17H21N3O3S — CID 9179817
N-benzyl-N-[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]benzenesulfonamide (PubChem CID 9179817) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-benzyl-N-[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]benzenesulfonamide.
| Compound Name | N-benzyl-N-[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9179817 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-benzyl-N-[2-(2,2-dimethylhydrazinyl)-2-oxoethyl]benzenesulfonamide |
| SMILES | CN(C)NC(=O)CN(Cc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H21N3O3S/c1-19(2)18-17(21)14-20(13-15-9-5-3-6-10-15)24(22,23)16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3,(H,18,21) |
| InChIKey | AKOCHMOEXZMTCZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|