C17H19BrN2O3S — CID 3136902
2-[benzyl-(4-bromophenyl)sulfonylamino]-N-ethylacetamide (PubChem CID 3136902) has the molecular formula C17H19BrN2O3S and a molecular weight of 411.30 g/mol. Its IUPAC name is 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-ethylacetamide.
| Compound Name | 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 3136902 |
| Molecular Formula | C17H19BrN2O3S |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(CC1=CC=CC=C1)S(=O)(=O)C2=CC=C(C=C2)Br |
| InChI | InChI=1S/C17H19BrN2O3S/c1-2-19-17(21)13-20(12-14-6-4-3-5-7-14)24(22,23)16-10-8-15(18)9-11-16/h3-11H,2,12-13H2,1H3,(H,19,21) |
| InChIKey | YGHPZEJNOFWSID-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | 492 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |