C16H16BrNO4S — CID 45472537
3-[benzyl-(4-bromophenyl)sulfonylamino]propanoic acid (PubChem CID 45472537) has the molecular formula C16H16BrNO4S and a molecular weight of 398.28 g/mol. Its IUPAC name is 3-[benzyl-(4-bromophenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[benzyl-(4-bromophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 45472537 |
| Molecular Formula | C16H16BrNO4S |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | 3-[benzyl-(4-bromophenyl)sulfonylamino]propanoic acid |
| SMILES | O=C(O)CCN(Cc1ccccc1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H16BrNO4S/c17-14-6-8-15(9-7-14)23(21,22)18(11-10-16(19)20)12-13-4-2-1-3-5-13/h1-9H,10-12H2,(H,19,20) |
| InChIKey | LLMKUJDBFHBBEW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |