C17H14Cl2F3NO3S — CID 100513141
3-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-4-methoxy-N-prop-2-enylbenzenesulfonamide (PubChem CID 100513141) has the molecular formula C17H14Cl2F3NO3S and a molecular weight of 440.27 g/mol. Its IUPAC name is 3-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-4-methoxy-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 3-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-4-methoxy-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 100513141 |
| Molecular Formula | C17H14Cl2F3NO3S |
| Molecular Weight | 440.27 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | 3-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-4-methoxy-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1ccc(Cl)c(C(F)(F)F)c1)S(=O)(=O)c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2F3NO3S/c1-3-8-23(11-4-6-14(18)13(9-11)17(20,21)22)27(24,25)12-5-7-16(26-2)15(19)10-12/h3-7,9-10H,1,8H2,2H3 |
| InChIKey | SSHXRKDSSUSDHG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.27 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|