C16H15ClF3NO3S — CID 100513964
3-chloro-N-ethyl-4-methoxy-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 100513964) has the molecular formula C16H15ClF3NO3S and a molecular weight of 393.81 g/mol. Its IUPAC name is 3-chloro-N-ethyl-4-methoxy-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-ethyl-4-methoxy-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 100513964 |
| Molecular Formula | C16H15ClF3NO3S |
| Molecular Weight | 393.81 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 3-chloro-N-ethyl-4-methoxy-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | CCN(c1ccc(C(F)(F)F)cc1)S(=O)(=O)c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C16H15ClF3NO3S/c1-3-21(12-6-4-11(5-7-12)16(18,19)20)25(22,23)13-8-9-15(24-2)14(17)10-13/h4-10H,3H2,1-2H3 |
| InChIKey | UCQXQOZNBLPWMS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.81 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |