C16H14Cl2F3NO3S — CID 100513742
3-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-N-ethyl-4-methoxybenzenesulfonamide (PubChem CID 100513742) has the molecular formula C16H14Cl2F3NO3S and a molecular weight of 428.26 g/mol. Its IUPAC name is 3-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-N-ethyl-4-methoxybenzenesulfonamide.
| Compound Name | 3-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-N-ethyl-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 100513742 |
| Molecular Formula | C16H14Cl2F3NO3S |
| Molecular Weight | 428.26 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | 3-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]-N-ethyl-4-methoxybenzenesulfonamide |
| SMILES | CCN(c1cc(C(F)(F)F)ccc1Cl)S(=O)(=O)c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2F3NO3S/c1-3-22(14-8-10(16(19,20)21)4-6-12(14)17)26(23,24)11-5-7-15(25-2)13(18)9-11/h4-9H,3H2,1-2H3 |
| InChIKey | SWRPHFBWDSIZIJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.26 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |