C19H22ClNO5S — CID 100514650
ethyl 4-[(3-chloro-4-methoxyphenyl)sulfonyl-ethylamino]-3-methylbenzoate (PubChem CID 100514650) has the molecular formula C19H22ClNO5S and a molecular weight of 411.91 g/mol. Its IUPAC name is ethyl 4-[(3-chloro-4-methoxyphenyl)sulfonyl-ethylamino]-3-methylbenzoate.
| Compound Name | ethyl 4-[(3-chloro-4-methoxyphenyl)sulfonyl-ethylamino]-3-methylbenzoate |
|---|---|
| PubChem CID | 100514650 |
| Molecular Formula | C19H22ClNO5S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | ethyl 4-[(3-chloro-4-methoxyphenyl)sulfonyl-ethylamino]-3-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(N(CC)S(=O)(=O)c2ccc(OC)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C19H22ClNO5S/c1-5-21(17-9-7-14(11-13(17)3)19(22)26-6-2)27(23,24)15-8-10-18(25-4)16(20)12-15/h7-12H,5-6H2,1-4H3 |
| InChIKey | RFOXXFUZGKOPSK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |