C14H14ClNO3S2 — CID 100549879
N-(3-chloro-4-methoxyphenyl)-N-prop-2-enylthiophene-2-sulfonamide (PubChem CID 100549879) has the molecular formula C14H14ClNO3S2 and a molecular weight of 343.86 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-N-prop-2-enylthiophene-2-sulfonamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-N-prop-2-enylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 100549879 |
| Molecular Formula | C14H14ClNO3S2 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-N-prop-2-enylthiophene-2-sulfonamide |
| SMILES | C=CCN(c1ccc(OC)c(Cl)c1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H14ClNO3S2/c1-3-8-16(21(17,18)14-5-4-9-20-14)11-6-7-13(19-2)12(15)10-11/h3-7,9-10H,1,8H2,2H3 |
| InChIKey | HKHLPSQQSTWNMF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|