C15H17NO6S2 — CID 100548774
methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate (PubChem CID 100548774) has the molecular formula C15H17NO6S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate.
| Compound Name | methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate |
|---|---|
| PubChem CID | 100548774 |
| Molecular Formula | C15H17NO6S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate |
| SMILES | COC(=O)CN(c1ccc(OC)c(OC)c1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H17NO6S2/c1-20-12-7-6-11(9-13(12)21-2)16(10-14(17)22-3)24(18,19)15-5-4-8-23-15/h4-9H,10H2,1-3H3 |
| InChIKey | HAWJVMNOFABLRY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |