methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate

C15H17NO6S2 — CID 100548774

IUPACmethyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate
SMILESCOC(=O)CN(c1ccc(OC)c(OC)c1)S(=O)(=O)c1cccs1
InChIInChI=1S/C15H17NO6S2/c1-20-12-7-6-11(9-13(12)21-2)16(10-14(17)22-3)24(18,19)15-5-4-8-23-15/h4-9H,10H2,1-3H3
InChIKeyHAWJVMNOFABLRY-UHFFFAOYSA-N
MW371.44 g/mol
LogP2.13
Rot. Bonds7

About methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate

methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate (PubChem CID 100548774) has the molecular formula C15H17NO6S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate.

Molecular Properties

Compound Namemethyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate
PubChem CID100548774
Molecular FormulaC15H17NO6S2
Molecular Weight371.44 g/mol
Exact Mass371.05
IUPAC Namemethyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate
SMILESCOC(=O)CN(c1ccc(OC)c(OC)c1)S(=O)(=O)c1cccs1
InChIInChI=1S/C15H17NO6S2/c1-20-12-7-6-11(9-13(12)21-2)16(10-14(17)22-3)24(18,19)15-5-4-8-23-15/h4-9H,10H2,1-3H3
InChIKeyHAWJVMNOFABLRY-UHFFFAOYSA-N
XLogP2.13
TPSA82.14 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500371.44
LogP ≤ 52.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate?
The IUPAC name of methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate (CID 100548774) is methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate.
What is the SMILES notation for methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate?
The canonical SMILES for methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate is COC(=O)CN(c1ccc(OC)c(OC)c1)S(=O)(=O)c1cccs1.
What is the InChIKey of methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate?
The InChIKey is HAWJVMNOFABLRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO6S2/c1-20-12-7-6-11(9-13(12)21-2)16(10-14(17)22-3)24(18,19)15-5-4-8-23-15/h4-9H,10H2,1-3H3.
What are the key properties of methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate?
methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate has a molecular weight of 371.44 g/mol, XLogP of 2.13, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,4-dimethoxy-N-thiophen-2-ylsulfonylanilino)acetate is sourced from PubChem (CID 100548774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).