C16H16ClNO6S2 — CID 100551525
methyl 2-chloro-5-[(2-ethoxy-2-oxoethyl)-thiophen-2-ylsulfonylamino]benzoate (PubChem CID 100551525) has the molecular formula C16H16ClNO6S2 and a molecular weight of 417.89 g/mol. Its IUPAC name is methyl 2-chloro-5-[(2-ethoxy-2-oxoethyl)-thiophen-2-ylsulfonylamino]benzoate.
| Compound Name | methyl 2-chloro-5-[(2-ethoxy-2-oxoethyl)-thiophen-2-ylsulfonylamino]benzoate |
|---|---|
| PubChem CID | 100551525 |
| Molecular Formula | C16H16ClNO6S2 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | methyl 2-chloro-5-[(2-ethoxy-2-oxoethyl)-thiophen-2-ylsulfonylamino]benzoate |
| SMILES | CCOC(=O)CN(c1ccc(Cl)c(C(=O)OC)c1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H16ClNO6S2/c1-3-24-14(19)10-18(26(21,22)15-5-4-8-25-15)11-6-7-13(17)12(9-11)16(20)23-2/h4-9H,3,10H2,1-2H3 |
| InChIKey | FGLJERSITLPQFC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |