C17H21NO4S2 — CID 100550650
ethyl 2-(2,4,6-trimethyl-N-thiophen-2-ylsulfonylanilino)acetate (PubChem CID 100550650) has the molecular formula C17H21NO4S2 and a molecular weight of 367.49 g/mol. Its IUPAC name is ethyl 2-(2,4,6-trimethyl-N-thiophen-2-ylsulfonylanilino)acetate.
| Compound Name | ethyl 2-(2,4,6-trimethyl-N-thiophen-2-ylsulfonylanilino)acetate |
|---|---|
| PubChem CID | 100550650 |
| Molecular Formula | C17H21NO4S2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | ethyl 2-(2,4,6-trimethyl-N-thiophen-2-ylsulfonylanilino)acetate |
| SMILES | CCOC(=O)CN(c1c(C)cc(C)cc1C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H21NO4S2/c1-5-22-15(19)11-18(24(20,21)16-7-6-8-23-16)17-13(3)9-12(2)10-14(17)4/h6-10H,5,11H2,1-4H3 |
| InChIKey | FAXJAKZJLGXZHX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |