C15H19NO2S2 — CID 100550599
N-ethyl-N-(2,4,6-trimethylphenyl)thiophene-2-sulfonamide (PubChem CID 100550599) has the molecular formula C15H19NO2S2 and a molecular weight of 309.46 g/mol. Its IUPAC name is N-ethyl-N-(2,4,6-trimethylphenyl)thiophene-2-sulfonamide.
| Compound Name | N-ethyl-N-(2,4,6-trimethylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 100550599 |
| Molecular Formula | C15H19NO2S2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N-ethyl-N-(2,4,6-trimethylphenyl)thiophene-2-sulfonamide |
| SMILES | CCN(c1c(C)cc(C)cc1C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H19NO2S2/c1-5-16(20(17,18)14-7-6-8-19-14)15-12(3)9-11(2)10-13(15)4/h6-10H,5H2,1-4H3 |
| InChIKey | FNRLQHOXTYTHOD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |