C13H13F2NO2S2 — CID 2342115
N-(difluoromethyl)-N-(2,4-dimethylphenyl)thiophene-2-sulfonamide (PubChem CID 2342115) has the molecular formula C13H13F2NO2S2 and a molecular weight of 317.38 g/mol. Its IUPAC name is N-(difluoromethyl)-N-(2,4-dimethylphenyl)thiophene-2-sulfonamide.
| Compound Name | N-(difluoromethyl)-N-(2,4-dimethylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2342115 |
| Molecular Formula | C13H13F2NO2S2 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-(difluoromethyl)-N-(2,4-dimethylphenyl)thiophene-2-sulfonamide |
| SMILES | Cc1ccc(N(C(F)F)S(=O)(=O)c2cccs2)c(C)c1 |
| InChI | InChI=1S/C13H13F2NO2S2/c1-9-5-6-11(10(2)8-9)16(13(14)15)20(17,18)12-4-3-7-19-12/h3-8,13H,1-2H3 |
| InChIKey | XOGIQTAMPWITFG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|