C13H16N2O2S2 — CID 62003332
4-amino-N-(2,4-dimethylphenyl)-N-methylthiophene-2-sulfonamide (PubChem CID 62003332) has the molecular formula C13H16N2O2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 4-amino-N-(2,4-dimethylphenyl)-N-methylthiophene-2-sulfonamide.
| Compound Name | 4-amino-N-(2,4-dimethylphenyl)-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 62003332 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-amino-N-(2,4-dimethylphenyl)-N-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(N(C)S(=O)(=O)c2cc(N)cs2)c(C)c1 |
| InChI | InChI=1S/C13H16N2O2S2/c1-9-4-5-12(10(2)6-9)15(3)19(16,17)13-7-11(14)8-18-13/h4-8H,14H2,1-3H3 |
| InChIKey | PNVVLOPXCCQHDL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |