thiophene-2-(18F)sulfonyl fluoride

C4H3FO2S2 — CID 72736656

IUPACthiophene-2-(18F)sulfonyl fluoride
SMILESO=S(=O)([18F])c1cccs1
InChIInChI=1S/C4H3FO2S2/c5-9(6,7)4-2-1-3-8-4/h1-3H/i5-1
InChIKeyNYJIUCJXMLNPHU-SFIIULIVSA-N
MW165.20 g/mol
LogP1.41
Rot. Bonds1

About thiophene-2-(18F)sulfonyl fluoride

thiophene-2-(18F)sulfonyl fluoride (PubChem CID 72736656) has the molecular formula C4H3FO2S2 and a molecular weight of 165.20 g/mol. Its IUPAC name is thiophene-2-(18F)sulfonyl fluoride.

Molecular Properties

Compound Namethiophene-2-(18F)sulfonyl fluoride
PubChem CID72736656
Molecular FormulaC4H3FO2S2
Molecular Weight165.20 g/mol
Exact Mass164.96
IUPAC Namethiophene-2-(18F)sulfonyl fluoride
SMILESO=S(=O)([18F])c1cccs1
InChIInChI=1S/C4H3FO2S2/c5-9(6,7)4-2-1-3-8-4/h1-3H/i5-1
InChIKeyNYJIUCJXMLNPHU-SFIIULIVSA-N
XLogP1.41
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.20
LogP ≤ 51.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze thiophene-2-(18F)sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of thiophene-2-(18F)sulfonyl fluoride?
The IUPAC name of thiophene-2-(18F)sulfonyl fluoride (CID 72736656) is thiophene-2-(18F)sulfonyl fluoride.
What is the SMILES notation for thiophene-2-(18F)sulfonyl fluoride?
The canonical SMILES for thiophene-2-(18F)sulfonyl fluoride is O=S(=O)([18F])c1cccs1.
What is the InChIKey of thiophene-2-(18F)sulfonyl fluoride?
The InChIKey is NYJIUCJXMLNPHU-SFIIULIVSA-N. The full InChI is InChI=1S/C4H3FO2S2/c5-9(6,7)4-2-1-3-8-4/h1-3H/i5-1.
What are the key properties of thiophene-2-(18F)sulfonyl fluoride?
thiophene-2-(18F)sulfonyl fluoride has a molecular weight of 165.20 g/mol, XLogP of 1.41, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene-2-(18F)sulfonyl fluoride is sourced from PubChem (CID 72736656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).