ethane;thiophene-2-sulfonyl chloride

C6H9ClO2S2 — CID 91564390

IUPACethane;thiophene-2-sulfonyl chloride
SMILESCC.O=S(=O)(Cl)c1cccs1
InChIInChI=1S/C4H3ClO2S2.C2H6/c5-9(6,7)4-2-1-3-8-4;1-2/h1-3H;1-2H3
InChIKeySLWSGJQUXWVJKP-UHFFFAOYSA-N
MW212.72 g/mol
LogP2.70
Rot. Bonds1

About ethane;thiophene-2-sulfonyl chloride

ethane;thiophene-2-sulfonyl chloride (PubChem CID 91564390) has the molecular formula C6H9ClO2S2 and a molecular weight of 212.72 g/mol. Its IUPAC name is ethane;thiophene-2-sulfonyl chloride.

Molecular Properties

Compound Nameethane;thiophene-2-sulfonyl chloride
PubChem CID91564390
Molecular FormulaC6H9ClO2S2
Molecular Weight212.72 g/mol
Exact Mass211.97
IUPAC Nameethane;thiophene-2-sulfonyl chloride
SMILESCC.O=S(=O)(Cl)c1cccs1
InChIInChI=1S/C4H3ClO2S2.C2H6/c5-9(6,7)4-2-1-3-8-4;1-2/h1-3H;1-2H3
InChIKeySLWSGJQUXWVJKP-UHFFFAOYSA-N
XLogP2.70
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.72
LogP ≤ 52.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethane;thiophene-2-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;thiophene-2-sulfonyl chloride?
The IUPAC name of ethane;thiophene-2-sulfonyl chloride (CID 91564390) is ethane;thiophene-2-sulfonyl chloride.
What is the SMILES notation for ethane;thiophene-2-sulfonyl chloride?
The canonical SMILES for ethane;thiophene-2-sulfonyl chloride is CC.O=S(=O)(Cl)c1cccs1.
What is the InChIKey of ethane;thiophene-2-sulfonyl chloride?
The InChIKey is SLWSGJQUXWVJKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3ClO2S2.C2H6/c5-9(6,7)4-2-1-3-8-4;1-2/h1-3H;1-2H3.
What are the key properties of ethane;thiophene-2-sulfonyl chloride?
ethane;thiophene-2-sulfonyl chloride has a molecular weight of 212.72 g/mol, XLogP of 2.70, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;thiophene-2-sulfonyl chloride is sourced from PubChem (CID 91564390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).