N-methylthiophene-2-sulfonamide;molecular hydrogen

C5H9NO2S2 — CID 143039868

IUPACN-methylthiophene-2-sulfonamide;molecular hydrogen
SMILESCNS(=O)(=O)c1cccs1.[H][H]
InChIInChI=1S/C5H7NO2S2.H2/c1-6-10(7,8)5-3-2-4-9-5;/h2-4,6H,1H3;1H
InChIKeyHPWZICFXQQELOS-UHFFFAOYSA-N
MW179.27 g/mol
LogP0.90
Rot. Bonds2

About N-methylthiophene-2-sulfonamide;molecular hydrogen

N-methylthiophene-2-sulfonamide;molecular hydrogen (PubChem CID 143039868) has the molecular formula C5H9NO2S2 and a molecular weight of 179.27 g/mol. Its IUPAC name is N-methylthiophene-2-sulfonamide;molecular hydrogen.

Molecular Properties

Compound NameN-methylthiophene-2-sulfonamide;molecular hydrogen
PubChem CID143039868
Molecular FormulaC5H9NO2S2
Molecular Weight179.27 g/mol
Exact Mass179.01
IUPAC NameN-methylthiophene-2-sulfonamide;molecular hydrogen
SMILESCNS(=O)(=O)c1cccs1.[H][H]
InChIInChI=1S/C5H7NO2S2.H2/c1-6-10(7,8)5-3-2-4-9-5;/h2-4,6H,1H3;1H
InChIKeyHPWZICFXQQELOS-UHFFFAOYSA-N
XLogP0.90
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.27
LogP ≤ 50.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze N-methylthiophene-2-sulfonamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-methylthiophene-2-sulfonamide;molecular hydrogen?
The IUPAC name of N-methylthiophene-2-sulfonamide;molecular hydrogen (CID 143039868) is N-methylthiophene-2-sulfonamide;molecular hydrogen.
What is the SMILES notation for N-methylthiophene-2-sulfonamide;molecular hydrogen?
The canonical SMILES for N-methylthiophene-2-sulfonamide;molecular hydrogen is CNS(=O)(=O)c1cccs1.[H][H].
What is the InChIKey of N-methylthiophene-2-sulfonamide;molecular hydrogen?
The InChIKey is HPWZICFXQQELOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2S2.H2/c1-6-10(7,8)5-3-2-4-9-5;/h2-4,6H,1H3;1H.
What are the key properties of N-methylthiophene-2-sulfonamide;molecular hydrogen?
N-methylthiophene-2-sulfonamide;molecular hydrogen has a molecular weight of 179.27 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylthiophene-2-sulfonamide;molecular hydrogen is sourced from PubChem (CID 143039868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).