C16H21NO2S2 — CID 769134
N-[2,6-di(propan-2-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 769134) has the molecular formula C16H21NO2S2 and a molecular weight of 323.48 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 769134 |
| Molecular Formula | C16H21NO2S2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H21NO2S2/c1-11(2)13-7-5-8-14(12(3)4)16(13)17-21(18,19)15-9-6-10-20-15/h5-12,17H,1-4H3 |
| InChIKey | ZHLJSKJSZNHSJZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |