C14H17N3O2S3 — CID 25039011
1-propan-2-yl-3-[2-(thiophen-2-ylsulfonylamino)phenyl]thiourea (PubChem CID 25039011) has the molecular formula C14H17N3O2S3 and a molecular weight of 355.51 g/mol. Its IUPAC name is 1-propan-2-yl-3-[2-(thiophen-2-ylsulfonylamino)phenyl]thiourea.
| Compound Name | 1-propan-2-yl-3-[2-(thiophen-2-ylsulfonylamino)phenyl]thiourea |
|---|---|
| PubChem CID | 25039011 |
| Molecular Formula | C14H17N3O2S3 |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 1-propan-2-yl-3-[2-(thiophen-2-ylsulfonylamino)phenyl]thiourea |
| SMILES | CC(C)NC(=S)Nc1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H17N3O2S3/c1-10(2)15-14(20)16-11-6-3-4-7-12(11)17-22(18,19)13-8-5-9-21-13/h3-10,17H,1-2H3,(H2,15,16,20) |
| InChIKey | JVOIQEIUGUENCX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|