C18H18N2O5S2 — CID 25391540
(1R,6R)-6-[[2-(thiophen-2-ylsulfonylamino)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 25391540) has the molecular formula C18H18N2O5S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is (1R,6R)-6-[[2-(thiophen-2-ylsulfonylamino)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6R)-6-[[2-(thiophen-2-ylsulfonylamino)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 25391540 |
| Molecular Formula | C18H18N2O5S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | (1R,6R)-6-[[2-(thiophen-2-ylsulfonylamino)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC=CC[C@H]1C(=O)Nc1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C18H18N2O5S2/c21-17(12-6-1-2-7-13(12)18(22)23)19-14-8-3-4-9-15(14)20-27(24,25)16-10-5-11-26-16/h1-5,8-13,20H,6-7H2,(H,19,21)(H,22,23)/t12-,13-/m1/s1 |
| InChIKey | ZNZHVJHJFLPPAI-CHWSQXEVSA-N |
| XLogP | 3.15 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|