C16H17N3O4S2 — CID 43016985
N-[2-[[(2-methylcyclopropanecarbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 43016985) has the molecular formula C16H17N3O4S2 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[2-[[(2-methylcyclopropanecarbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[[(2-methylcyclopropanecarbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 43016985 |
| Molecular Formula | C16H17N3O4S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | N-[2-[[(2-methylcyclopropanecarbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | CC1CC1C(=O)NNC(=O)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H17N3O4S2/c1-10-9-12(10)16(21)18-17-15(20)11-5-2-3-6-13(11)19-25(22,23)14-7-4-8-24-14/h2-8,10,12,19H,9H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | FPRZAEGYIIZZGE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|